Products 1285987-04-3
CAS 1285987-04-3 is the registry number for 4-((2-Methyl-1-isopropyl-d6)pentyl)phenol(Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 100mg.
4-[1,1,1-trideuterio-4-methyl-2-(trideuteriomethyl)heptan-3-yl]phenol (CAS 1285987-04-3) is a chemical compound with the molecular formula C15H24O and a molecular weight of 226.39 g/mol. IUPAC name: 4-[1,1,1-trideuterio-4-methyl-2-(trideuteriomethyl)heptan-3-yl]phenol. InChIKey: KQABNOBNXAJBFQ-XERRXZQWSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 226.39 g/mol |
| IUPAC name | 4-[1,1,1-trideuterio-4-methyl-2-(trideuteriomethyl)heptan-3-yl]phenol |
| InChIKey | KQABNOBNXAJBFQ-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])C(C(C1=CC=C(C=C1)O)C(C)CCC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)