CAS 1286734-84-6 appears in our catalog under these names: 2–(Trifluoromethyl)thiazole–5–carboxylic acid, 2-(Trifluoromethyl)thiazole-5-carboxylic acid 95%, 2-(Trifluoromethyl)thiazole-5-carboxylic acid, 95%, 95%, 2-(Trifluoromethyl)thiazole-5-carboxylic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 10g, 50g.
2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 1286734-84-6) is a chemical compound with the molecular formula C5H2F3NO2S and a molecular weight of 197.14 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: POPWMBOAMPURLZ-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO2S |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | POPWMBOAMPURLZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)