CAS 900530-68-9 appears in our catalog under these names: 5-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid, 95%, 5-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid, 5-(Trifluoromethyl)thiazole-4-carboxylic acid 98%, 5-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid, 95%, 95%, 5-(Trifluoromethyl)-1,3-thiazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg.
5-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid (CAS 900530-68-9) is a chemical compound with the molecular formula C5H2F3NO2S and a molecular weight of 197.14 g/mol. IUPAC name: 5-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid. InChIKey: MESLCUOAZZCUOE-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO2S |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | MESLCUOAZZCUOE-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)