CAS 1487375-88-1 is the registry number for 3-(Trifluoromethyl)isothiazole-5-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 25mg.
3-(trifluoromethyl)-1,2-thiazole-5-carboxylic acid (CAS 1487375-88-1) is a chemical compound with the molecular formula C5H2F3NO2S and a molecular weight of 197.14 g/mol. IUPAC name: 3-(trifluoromethyl)-1,2-thiazole-5-carboxylic acid. InChIKey: DTSDLWAOZTXSRD-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO2S |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3-(trifluoromethyl)-1,2-thiazole-5-carboxylic acid |
| InChIKey | DTSDLWAOZTXSRD-UHFFFAOYSA-N |
| SMILES | C1=C(SN=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)