Products 2377611-57-7
CAS 2377611-57-7 is the registry number for 2-Chloroquinoline-8-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2-chloroquinolin-8-yl)boronic acid (CAS 2377611-57-7) is a chemical compound with the molecular formula C9H7BClNO2 and a molecular weight of 207.42 g/mol. IUPAC name: (2-chloroquinolin-8-yl)boronic acid. InChIKey: IDAQLQMJZCELGQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BClNO2 |
|---|---|
| Molecular weight | 207.42 g/mol |
| IUPAC name | (2-chloroquinolin-8-yl)boronic acid |
| InChIKey | IDAQLQMJZCELGQ-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=CC(=N2)Cl)(O)O |
Computed by PubChem (NCBI)