CAS 2096331-38-1 is the registry number for 3-Chloroisoquinolin-7-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
(3-chloroisoquinolin-7-yl)boronic acid (CAS 2096331-38-1) is a chemical compound with the molecular formula C9H7BClNO2 and a molecular weight of 207.42 g/mol. IUPAC name: (3-chloroisoquinolin-7-yl)boronic acid. InChIKey: LFDFGQMNAXLLIK-UHFFFAOYSA-N.
| Molecular formula | C9H7BClNO2 |
|---|---|
| Molecular weight | 207.42 g/mol |
| IUPAC name | (3-chloroisoquinolin-7-yl)boronic acid |
| InChIKey | LFDFGQMNAXLLIK-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CN=C(C=C2C=C1)Cl)(O)O |
Computed by PubChem (NCBI)