Products 1286792-88-8

CAS 1286792-88-8 is the registry number for Ethyl difluoro(4-phenylimidazole-5-yl)acetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-2-(4-phenyl-1H-imidazol-5-yl)acetate (CAS 1286792-88-8) is a chemical compound with the molecular formula C13H12F2N2O2 and a molecular weight of 266.24 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(4-phenyl-1H-imidazol-5-yl)acetate. InChIKey: HGJSIWBQRLYGLG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12F2N2O2
Molecular weight266.24 g/mol
IUPAC nameethyl 2,2-difluoro-2-(4-phenyl-1H-imidazol-5-yl)acetate
InChIKeyHGJSIWBQRLYGLG-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=C(N=CN1)C2=CC=CC=C2)(F)F

Computed by PubChem (NCBI)