CAS 1457694-66-4 is the registry number for Ethyl 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylate (CAS 1457694-66-4) is a chemical compound with the molecular formula C13H12F2N2O2 and a molecular weight of 266.24 g/mol. IUPAC name: ethyl 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylate. InChIKey: IUDBMHLHVNKFHJ-UHFFFAOYSA-N.
| Molecular formula | C13H12F2N2O2 |
|---|---|
| Molecular weight | 266.24 g/mol |
| IUPAC name | ethyl 2-(2,4-difluorophenyl)-5-methyl-1H-imidazole-4-carboxylate |
| InChIKey | IUDBMHLHVNKFHJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=N1)C2=C(C=C(C=C2)F)F)C |
Computed by PubChem (NCBI)