CAS 1361019-08-0 appears in our catalog under these names: Ethyl 5-(2,6-difluorophenyl)-1-methyl-1h-pyrazole-3-carboxylate, 95%, Ethyl 5–(2,6–difluorophenyl)–1–methyl–1h–pyrazole–3–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 5-(2,6-difluorophenyl)-1-methylpyrazole-3-carboxylate (CAS 1361019-08-0) is a chemical compound with the molecular formula C13H12F2N2O2 and a molecular weight of 266.24 g/mol. IUPAC name: ethyl 5-(2,6-difluorophenyl)-1-methylpyrazole-3-carboxylate. InChIKey: PUWBXNQNPHVRJT-UHFFFAOYSA-N.
| Molecular formula | C13H12F2N2O2 |
|---|---|
| Molecular weight | 266.24 g/mol |
| IUPAC name | ethyl 5-(2,6-difluorophenyl)-1-methylpyrazole-3-carboxylate |
| InChIKey | PUWBXNQNPHVRJT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=C1)C2=C(C=CC=C2F)F)C |
Computed by PubChem (NCBI)