Products 128746-57-6

CAS 128746-57-6 is the registry number for 8-((2,5-Dioxopyrrolidin-1-yl)oxy)-8-oxooctanoic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctanoic acid (CAS 128746-57-6) is a chemical compound with the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. IUPAC name: 8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctanoic acid. InChIKey: NVWKYNBWYYJZTK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO6
Molecular weight271.27 g/mol
IUPAC name8-(2,5-dioxopyrrolidin-1-yl)oxy-8-oxooctanoic acid
InChIKeyNVWKYNBWYYJZTK-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)CCCCCCC(=O)O

Computed by PubChem (NCBI)