CAS 20818-25-1 appears in our catalog under these names: 4-Aminophenyl beta-d-glucopyranoside, 95%, 4–Aminophenyl β–D–glucopyranoside, 4-Aminophenyl b-D-glucopyranoside, 4-Aminophenyl β-D-glucopyranoside 96%, 4-Aminophenyl β-D-glucopyranoside, 98.93%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 500mg, 1000mg, 2000mg, 25mg, 50mg.
(2S,3R,4S,5S,6R)-2-(4-aminophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 20818-25-1) is a chemical compound with the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-(4-aminophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: MIAKOEWBCMPCQR-RMPHRYRLSA-N.
| Molecular formula | C12H17NO6 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-(4-aminophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | MIAKOEWBCMPCQR-RMPHRYRLSA-N |
| SMILES | C1=CC(=CC=C1N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)