CAS 31302-52-0 appears in our catalog under these names: Paph-alpha-d-glc, 95%, 4-Aminophenyl a-D-Glucopyranoside, 4-Aminophenyl Alpha-D-Glucopyranoside, p–Aminophenyl α–D–glucopyranoside, p-Aminophenyl α-D-glucopyranoside 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 10mg, 50mg, 0,25g, 0,1g, 0,5g.
(2R,3R,4S,5R,6R)-2-(4-aminophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 31302-52-0) is a chemical compound with the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-2-(4-aminophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: MIAKOEWBCMPCQR-IIRVCBMXSA-N.
| Molecular formula | C12H17NO6 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-2-(4-aminophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | MIAKOEWBCMPCQR-IIRVCBMXSA-N |
| SMILES | C1=CC(=CC=C1N)O[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)