CAS 1287753-34-7 appears in our catalog under these names: [4-Methoxy-2-(1h-pyrazol-1-yl)phenyl]boronic acid, 97%, (4-Methoxy-2-(1H-pyrazol-1-yl)phenyl)boronic acid, 95+%, (4–Methoxy–2–(1H–pyrazol–1–yl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
(4-methoxy-2-pyrazol-1-ylphenyl)boronic acid (CAS 1287753-34-7) is a chemical compound with the molecular formula C10H11BN2O3 and a molecular weight of 218.02 g/mol. IUPAC name: (4-methoxy-2-pyrazol-1-ylphenyl)boronic acid. InChIKey: HNIWENQDOKNTLY-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O3 |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | (4-methoxy-2-pyrazol-1-ylphenyl)boronic acid |
| InChIKey | HNIWENQDOKNTLY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)N2C=CC=N2)(O)O |
Computed by PubChem (NCBI)