CAS 2096339-56-7 appears in our catalog under these names: 3-(5-Ethyl-1,2,4-oxadiazol-3-yl)phenylboronic acid, 95%, (3-(5-Ethyl-1,2,4-oxadiazol-3-yl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid (CAS 2096339-56-7) is a chemical compound with the molecular formula C10H11BN2O3 and a molecular weight of 218.02 g/mol. IUPAC name: [3-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid. InChIKey: PJKLYGGFHUZTEP-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O3 |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | [3-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid |
| InChIKey | PJKLYGGFHUZTEP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NOC(=N2)CC)(O)O |
Computed by PubChem (NCBI)