Products 1598409-63-2
CAS 1598409-63-2 is the registry number for [1-(Oxetan-3-yl)-1H-indazol-5-yl]boronic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(oxetan-3-yl)indazol-5-yl]boronic acid (CAS 1598409-63-2) is a chemical compound with the molecular formula C10H11BN2O3 and a molecular weight of 218.02 g/mol. IUPAC name: [1-(oxetan-3-yl)indazol-5-yl]boronic acid. InChIKey: RFEONICLPXVGTQ-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O3 |
|---|---|
| Molecular weight | 218.02 g/mol |
| IUPAC name | [1-(oxetan-3-yl)indazol-5-yl]boronic acid |
| InChIKey | RFEONICLPXVGTQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(N=C2)C3COC3)(O)O |
Computed by PubChem (NCBI)