CAS 1287753-37-0 is the registry number for [2-(3,5-Dimethyl-1h-pyrazol-1-yl)-4-methoxyphenyl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
[2-(3,5-dimethylpyrazol-1-yl)-4-methoxyphenyl]boronic acid (CAS 1287753-37-0) is a chemical compound with the molecular formula C12H15BN2O3 and a molecular weight of 246.07 g/mol. IUPAC name: [2-(3,5-dimethylpyrazol-1-yl)-4-methoxyphenyl]boronic acid. InChIKey: SMUCSGQOJLQYHU-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O3 |
|---|---|
| Molecular weight | 246.07 g/mol |
| IUPAC name | [2-(3,5-dimethylpyrazol-1-yl)-4-methoxyphenyl]boronic acid |
| InChIKey | SMUCSGQOJLQYHU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)N2C(=CC(=N2)C)C)(O)O |
Computed by PubChem (NCBI)