Products 2377605-89-3
CAS 2377605-89-3 appears in our catalog under these names: [3-(5-tert-Butyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid, 98%, (3-(5-tert-Butyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-(5-tert-butyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid (CAS 2377605-89-3) is a chemical compound with the molecular formula C12H15BN2O3 and a molecular weight of 246.07 g/mol. IUPAC name: [3-(5-tert-butyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid. InChIKey: FCTXYYWBCRRLMN-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O3 |
|---|---|
| Molecular weight | 246.07 g/mol |
| IUPAC name | [3-(5-tert-butyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid |
| InChIKey | FCTXYYWBCRRLMN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NN=C(O2)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)