Products 2377611-33-9
CAS 2377611-33-9 appears in our catalog under these names: [4-(5-Butyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid, 98%, (4-(5-Butyl-1,2,4-oxadiazol-3-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
[4-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid (CAS 2377611-33-9) is a chemical compound with the molecular formula C12H15BN2O3 and a molecular weight of 246.07 g/mol. IUPAC name: [4-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid. InChIKey: NSHFFNSYLOHSOL-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O3 |
|---|---|
| Molecular weight | 246.07 g/mol |
| IUPAC name | [4-(5-butyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid |
| InChIKey | NSHFFNSYLOHSOL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NOC(=N2)CCCC)(O)O |
Computed by PubChem (NCBI)