Products 128852-15-3

CAS 128852-15-3 is the registry number for 3,4-Dibromothiophene-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,4-dibromothiophene-2-sulfonyl chloride (CAS 128852-15-3) is a chemical compound with the molecular formula C4HBr2ClO2S2 and a molecular weight of 340.4 g/mol. IUPAC name: 3,4-dibromothiophene-2-sulfonyl chloride. InChIKey: OLSYJMFARDELRE-UHFFFAOYSA-N.

Identity
Molecular formulaC4HBr2ClO2S2
Molecular weight340.4 g/mol
IUPAC name3,4-dibromothiophene-2-sulfonyl chloride
InChIKeyOLSYJMFARDELRE-UHFFFAOYSA-N
SMILESC1=C(C(=C(S1)S(=O)(=O)Cl)Br)Br

Computed by PubChem (NCBI)