CAS 128852-15-3 is the registry number for 3,4-Dibromothiophene-2-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,4-dibromothiophene-2-sulfonyl chloride (CAS 128852-15-3) is a chemical compound with the molecular formula C4HBr2ClO2S2 and a molecular weight of 340.4 g/mol. IUPAC name: 3,4-dibromothiophene-2-sulfonyl chloride. InChIKey: OLSYJMFARDELRE-UHFFFAOYSA-N.
| Molecular formula | C4HBr2ClO2S2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 3,4-dibromothiophene-2-sulfonyl chloride |
| InChIKey | OLSYJMFARDELRE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(S1)S(=O)(=O)Cl)Br)Br |
Computed by PubChem (NCBI)