CAS 81606-31-7 appears in our catalog under these names: 4,5-Dibromothiophene-2-sulfonyl chloride, 95%, 4,5-Dibromothiophene-2-sulfonyl chloride, 97% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g, 25g.
4,5-dibromothiophene-2-sulfonyl chloride (CAS 81606-31-7) is a chemical compound with the molecular formula C4HBr2ClO2S2 and a molecular weight of 340.4 g/mol. IUPAC name: 4,5-dibromothiophene-2-sulfonyl chloride. InChIKey: WJYGHWXWQSCONR-UHFFFAOYSA-N.
| Molecular formula | C4HBr2ClO2S2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4,5-dibromothiophene-2-sulfonyl chloride |
| InChIKey | WJYGHWXWQSCONR-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Br)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)