Products 70374-40-2

CAS 70374-40-2 is the registry number for 2,5-Dibromothiophene-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

2,5-Dibromothiophene-3-sulfonyl chloride
Biosynth
  • size: 0,5g, 50mg
  • Variants: 2
View product
Structural formula: {0} (CAS {1})

2,5-dibromothiophene-3-sulfonyl chloride (CAS 70374-40-2) is a chemical compound with the molecular formula C4HBr2ClO2S2 and a molecular weight of 340.4 g/mol. IUPAC name: 2,5-dibromothiophene-3-sulfonyl chloride. InChIKey: NXEZMVJAZXKXHR-UHFFFAOYSA-N.

Identity
Molecular formulaC4HBr2ClO2S2
Molecular weight340.4 g/mol
IUPAC name2,5-dibromothiophene-3-sulfonyl chloride
InChIKeyNXEZMVJAZXKXHR-UHFFFAOYSA-N
SMILESC1=C(SC(=C1S(=O)(=O)Cl)Br)Br

Computed by PubChem (NCBI)

Synonyms: 2,5-dibromothiophene-3-sulfonyl Chloride, 2,5-dibromo-3-thiophenesulfonyl chloride
Isomers (same molecular formula)
4,5-dibromothiophene-2-sulfonyl chloride C4HBr2ClO2S2
3,4-dibromothiophene-2-sulfonyl chloride C4HBr2ClO2S2
3,5-dibromothiophene-2-sulfonyl chloride C4HBr2ClO2S2