Products 128886-91-9
CAS 128886-91-9 appears in our catalog under these names: 4–(3–(Trifluoromethyl)–3H–diazirin–3–yl)benzonitrile, 4-(3-(Trifluoromethyl)-3H-diazirin-3-yl)benzonitrile. Offered by: GLPBio, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
4-[3-(trifluoromethyl)diazirin-3-yl]benzonitrile (CAS 128886-91-9) is a chemical compound with the molecular formula C9H4F3N3 and a molecular weight of 211.14 g/mol. IUPAC name: 4-[3-(trifluoromethyl)diazirin-3-yl]benzonitrile. InChIKey: MAWONWOMXRJQJP-UHFFFAOYSA-N.
| Molecular formula | C9H4F3N3 |
|---|---|
| Molecular weight | 211.14 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)diazirin-3-yl]benzonitrile |
| InChIKey | MAWONWOMXRJQJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2(N=N2)C(F)(F)F |
Computed by PubChem (NCBI)