Products 1288978-81-3
CAS 1288978-81-3 appears in our catalog under these names: 2-(4-Chloro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%, 2-(4-Chloro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(4-chloro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1288978-81-3) is a chemical compound with the molecular formula C12H15BClNO4 and a molecular weight of 283.52 g/mol. IUPAC name: 2-(4-chloro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SQTUTAYASGATCG-UHFFFAOYSA-N.
| Molecular formula | C12H15BClNO4 |
|---|---|
| Molecular weight | 283.52 g/mol |
| IUPAC name | 2-(4-chloro-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SQTUTAYASGATCG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)