CAS 1704082-36-9 is the registry number for (3–Chloro–4–(4–hydroxypiperidine–1–carbonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-chloro-4-(4-hydroxypiperidine-1-carbonyl)phenyl]boronic acid (CAS 1704082-36-9) is a chemical compound with the molecular formula C12H15BClNO4 and a molecular weight of 283.52 g/mol. IUPAC name: [3-chloro-4-(4-hydroxypiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: KNVBITGDGBWSOQ-UHFFFAOYSA-N.
| Molecular formula | C12H15BClNO4 |
|---|---|
| Molecular weight | 283.52 g/mol |
| IUPAC name | [3-chloro-4-(4-hydroxypiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | KNVBITGDGBWSOQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)N2CCC(CC2)O)Cl)(O)O |
Computed by PubChem (NCBI)