CAS 98243-59-5 appears in our catalog under these names: (5-Oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfonate, 95%, (5-Oxopyrrolidin-2-yl)methyl 4-methylbenzene-1-sulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfonate (CAS 98243-59-5) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: (5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfonate. InChIKey: AMZNHHZJURKRFX-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | (5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | AMZNHHZJURKRFX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CCC(=O)N2 |
Computed by PubChem (NCBI)