CAS 1288998-66-2 appears in our catalog under these names: 3–Methyl–5–nitro–1H–pyrrolo(2,3–b)pyridine, 3-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine 95%, 3-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine, 95%, 95%, 3-METHYL-5-NITRO-7-AZAINDOLE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g.
3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 1288998-66-2) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: IWQDJDICMFEZLB-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | IWQDJDICMFEZLB-UHFFFAOYSA-N |
| SMILES | CC1=CNC2=C1C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)