Products 1289005-35-1
CAS 1289005-35-1 is the registry number for Ethyl 5,7-dichloroimidazo[1,2-a]pyrimidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5,7-dichloroimidazo[1,2-a]pyrimidine-2-carboxylate (CAS 1289005-35-1) is a chemical compound with the molecular formula C9H7Cl2N3O2 and a molecular weight of 260.07 g/mol. IUPAC name: ethyl 5,7-dichloroimidazo[1,2-a]pyrimidine-2-carboxylate. InChIKey: OSMBQQMXFZDPDS-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3O2 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | ethyl 5,7-dichloroimidazo[1,2-a]pyrimidine-2-carboxylate |
| InChIKey | OSMBQQMXFZDPDS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C(=CC(=NC2=N1)Cl)Cl |
Computed by PubChem (NCBI)