CAS 1638771-51-3 is the registry number for 2,4-Dichloro-7-methyl-7h-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine-6-carboxylate (CAS 1638771-51-3) is a chemical compound with the molecular formula C9H7Cl2N3O2 and a molecular weight of 260.07 g/mol. IUPAC name: methyl 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine-6-carboxylate. InChIKey: PVAAUTJDSOADMB-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3O2 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | methyl 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | PVAAUTJDSOADMB-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C1N=C(N=C2Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)