Products 2594313-37-6
CAS 2594313-37-6 is the registry number for Ethyl 4,6-dichloro-1H-imidazo[4,5-c]pyridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4,6-dichloro-1H-imidazo[4,5-c]pyridine-2-carboxylate (CAS 2594313-37-6) is a chemical compound with the molecular formula C9H7Cl2N3O2 and a molecular weight of 260.07 g/mol. IUPAC name: ethyl 4,6-dichloro-1H-imidazo[4,5-c]pyridine-2-carboxylate. InChIKey: RTOUTTKRQUTHSR-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3O2 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | ethyl 4,6-dichloro-1H-imidazo[4,5-c]pyridine-2-carboxylate |
| InChIKey | RTOUTTKRQUTHSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(N=C(C=C2N1)Cl)Cl |
Computed by PubChem (NCBI)