Products 1289097-37-5

CAS 1289097-37-5 is the registry number for Methyl 2-((3-bromo-5-methylpyridin-2-yl)amino)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-[(3-bromo-5-methyl-2-pyridinyl)amino]acetate (CAS 1289097-37-5) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 2-[(3-bromo-5-methyl-2-pyridinyl)amino]acetate. InChIKey: XJKGMLMAGMUKCU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrN2O2
Molecular weight259.10 g/mol
IUPAC namemethyl 2-[(3-bromo-5-methyl-2-pyridinyl)amino]acetate
InChIKeyXJKGMLMAGMUKCU-UHFFFAOYSA-N
SMILESCC1=CC(=C(N=C1)NCC(=O)OC)Br

Computed by PubChem (NCBI)