CAS 1289386-42-0 is the registry number for 2-(((2,5-Dichlorobenzyl)oxy)methyl)piperidine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[(2,5-dichlorophenyl)methoxymethyl]piperidine;hydrochloride (CAS 1289386-42-0) is a chemical compound with the molecular formula C13H18Cl3NO and a molecular weight of 310.6 g/mol. IUPAC name: 2-[(2,5-dichlorophenyl)methoxymethyl]piperidine;hydrochloride. InChIKey: NZJDDYZURJEAMB-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl3NO |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | 2-[(2,5-dichlorophenyl)methoxymethyl]piperidine;hydrochloride |
| InChIKey | NZJDDYZURJEAMB-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)COCC2=C(C=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)