CAS 1346598-72-8 appears in our catalog under these names: Bupropion 3',4'-Dichloro Impurity, Bupropion Impurity 3, Bupropion Impurity 12 HCl, 2-(tert-Butylamino)-3’,4’-dichloropropiophenone Hydrochloride, >95% (HPLC), 4-Chloro Bupropion Hydrochloride. Offered by: Chemat Brand, TRC, Sigma-Aldrich, Chemat. Available pack sizes: on request, 100mg, 250mg, 50mg, 500mg, 25MG, 10mg.
2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one;hydrochloride (CAS 1346598-72-8) is a chemical compound with the molecular formula C13H18Cl3NO and a molecular weight of 310.6 g/mol. IUPAC name: 2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one;hydrochloride. InChIKey: YFAPNLTUNVYSBO-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl3NO |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one;hydrochloride |
| InChIKey | YFAPNLTUNVYSBO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=C(C=C1)Cl)Cl)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)