CAS 1346603-00-6 appears in our catalog under these names: Bupropion Impurity 13 HCl, Bupropion Impurity 11, 2-(tert-Butylamino)-3’,5’-dichloropropiophenone Hydrochloride, 2-(tert-Butylamino)-3’,5’-dichloropropiophenone Hydrochloride, 95%, 95%, 5-CHLORO BUPROPION HYDROCHLORIDE. Offered by: Chemat Brand, TRC, Chemat, Sigma-Aldrich. Available pack sizes: on request, 500mg, 10mg, 100mg, 25MG.
2-(tert-butylamino)-1-(3,5-dichlorophenyl)propan-1-one;hydrochloride (CAS 1346603-00-6) is a chemical compound with the molecular formula C13H18Cl3NO and a molecular weight of 310.6 g/mol. IUPAC name: 2-(tert-butylamino)-1-(3,5-dichlorophenyl)propan-1-one;hydrochloride. InChIKey: QQTNAMMMXBOUGH-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl3NO |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(3,5-dichlorophenyl)propan-1-one;hydrochloride |
| InChIKey | QQTNAMMMXBOUGH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC(=C1)Cl)Cl)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)