CAS 128979-10-2 appears in our catalog under these names: 4-Benzoyl-1,3-thiazole, 95%, 4-Benzoyl-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Phenyl(1,3-thiazol-4-yl)methanone (CAS 128979-10-2) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: phenyl(1,3-thiazol-4-yl)methanone. InChIKey: AMCLLNBFQNCVJN-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | phenyl(1,3-thiazol-4-yl)methanone |
| InChIKey | AMCLLNBFQNCVJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CSC=N2 |
Computed by PubChem (NCBI)