CAS 194930-00-2 appears in our catalog under these names: (S)-(-)-Rivastigmine-d6 L-Tartrate (N,N-dimethyl-d6), 99 atom % D, min 98% Chemical Purity, (S)-Rivastigmine D6 tartrate, (S)-Rivastigmine-d6 (tartrate), 99.0%. Offered by: CDN, TargetMol, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 5mg, 1 mg, 5 mg.
[3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 194930-00-2) is a chemical compound with the molecular formula C18H28N2O8 and a molecular weight of 406.5 g/mol. IUPAC name: [3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: GWHQHAUAXRMMOT-XVXYZIQCSA-N.
| Molecular formula | C18H28N2O8 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | [3-[(1S)-1-[bis(trideuteriomethyl)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | GWHQHAUAXRMMOT-XVXYZIQCSA-N |
| SMILES | [2H]C([2H])([2H])N([C@@H](C)C1=CC(=CC=C1)OC(=O)N(C)CC)C([2H])([2H])[2H].[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)