CAS 1291798-89-4 is the registry number for N2-(4-(Trifluoromethyl)phenyl)pyrimidine-2,5-diamine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,5-diamine (CAS 1291798-89-4) is a chemical compound with the molecular formula C11H9F3N4 and a molecular weight of 254.21 g/mol. IUPAC name: 2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,5-diamine. InChIKey: ICGDBUKQVVGOGA-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N4 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | 2-N-[4-(trifluoromethyl)phenyl]pyrimidine-2,5-diamine |
| InChIKey | ICGDBUKQVVGOGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC2=NC=C(C=N2)N |
Computed by PubChem (NCBI)