Products 1307190-72-2
CAS 1307190-72-2 appears in our catalog under these names: N2-[2-(Trifluoromethyl)phenyl]pyrimidine-2,5-diamine, 95%, N2-(2-(Trifluoromethyl)phenyl)pyrimidine-2,5-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-N-[2-(trifluoromethyl)phenyl]pyrimidine-2,5-diamine (CAS 1307190-72-2) is a chemical compound with the molecular formula C11H9F3N4 and a molecular weight of 254.21 g/mol. IUPAC name: 2-N-[2-(trifluoromethyl)phenyl]pyrimidine-2,5-diamine. InChIKey: WMONYJWTGPZHSV-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N4 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | 2-N-[2-(trifluoromethyl)phenyl]pyrimidine-2,5-diamine |
| InChIKey | WMONYJWTGPZHSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)NC2=NC=C(C=N2)N |
Computed by PubChem (NCBI)