CAS 383148-46-7 is the registry number for N-Methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-amine (CAS 383148-46-7) is a chemical compound with the molecular formula C11H9F3N4 and a molecular weight of 254.21 g/mol. IUPAC name: N-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-amine. InChIKey: VWCUKIMQFRFYEF-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N4 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | N-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-amine |
| InChIKey | VWCUKIMQFRFYEF-UHFFFAOYSA-N |
| SMILES | CNC1=C(N=NC(=N1)C2=CC=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)