Products 1292324-49-2

CAS 1292324-49-2 is the registry number for (S)-3-Methylamino-pyrrolidine-1-carboxylic acid benzyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Benzyl (3S)-3-(methylamino)pyrrolidine-1-carboxylate (CAS 1292324-49-2) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl (3S)-3-(methylamino)pyrrolidine-1-carboxylate. InChIKey: XGJOYHWLQXYOPI-LBPRGKRZSA-N.

Identity
Molecular formulaC13H18N2O2
Molecular weight234.29 g/mol
IUPAC namebenzyl (3S)-3-(methylamino)pyrrolidine-1-carboxylate
InChIKeyXGJOYHWLQXYOPI-LBPRGKRZSA-N
SMILESCN[C@H]1CCN(C1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)