Products 917357-83-6

CAS 917357-83-6 is the registry number for Benzyl (R)-3-(methylamino)pyrrolidine-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Benzyl 3-(methylamino)pyrrolidine-1-carboxylate (CAS 917357-83-6) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl 3-(methylamino)pyrrolidine-1-carboxylate. InChIKey: XGJOYHWLQXYOPI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O2
Molecular weight234.29 g/mol
IUPAC namebenzyl 3-(methylamino)pyrrolidine-1-carboxylate
InChIKeyXGJOYHWLQXYOPI-UHFFFAOYSA-N
SMILESCNC1CCN(C1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)