CAS 129253-02-7 is the registry number for N-Benzyl L-isoleucinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2S,3S)-2-amino-N-benzyl-3-methylpentanamide (CAS 129253-02-7) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: (2S,3S)-2-amino-N-benzyl-3-methylpentanamide. InChIKey: QCNUBIUWWWTVLZ-JQWIXIFHSA-N.
| Molecular formula | C13H20N2O |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | (2S,3S)-2-amino-N-benzyl-3-methylpentanamide |
| InChIKey | QCNUBIUWWWTVLZ-JQWIXIFHSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)