CAS 1292908-42-9 appears in our catalog under these names: Levamisole Impurity 6, 2-Hydroxy Levamisole. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
2-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenol (CAS 1292908-42-9) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 2-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenol. InChIKey: UWSRSQGOOOLTTI-SECBINFHSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 2-[(6S)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl]phenol |
| InChIKey | UWSRSQGOOOLTTI-SECBINFHSA-N |
| SMILES | C1CSC2=N[C@H](CN21)C3=CC=CC=C3O |
Computed by PubChem (NCBI)