Products 129297-52-5
CAS 129297-52-5 appears in our catalog under these names: 1-(4-Cyanophenyl)pyrrolidine-2-carboxylic acid, (S)-1-(4-Cyanophenyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 50mg, 100mg.
(2S)-1-(4-cyanophenyl)pyrrolidine-2-carboxylic acid (CAS 129297-52-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: (2S)-1-(4-cyanophenyl)pyrrolidine-2-carboxylic acid. InChIKey: QXPDICRRGHNHKO-NSHDSACASA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | (2S)-1-(4-cyanophenyl)pyrrolidine-2-carboxylic acid |
| InChIKey | QXPDICRRGHNHKO-NSHDSACASA-N |
| SMILES | C1C[C@H](N(C1)C2=CC=C(C=C2)C#N)C(=O)O |
Computed by PubChem (NCBI)