Products 129306-04-3
CAS 129306-04-3 appears in our catalog under these names: 5–Azaspiro(2·4)heptane–4，7–dione， 5–(phenylMethyl)–, 5-Azaspiro[2.4]heptane-4,7-dione, 5-(phenylMethyl)-, 98%, 98%, 5-Benzyl-5-azaspiro[2.4]heptane-4,7-dione, 99.93%, 5-(Phenylmethyl)-5-azaspiro[2.4]heptane-4,7-dione, 98%, 5-Benzyl-5-azaspiro[2.4]heptane-4,7-dione, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 50g, 1 g.
5-benzyl-5-azaspiro[2.4]heptane-4,7-dione (CAS 129306-04-3) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 5-benzyl-5-azaspiro[2.4]heptane-4,7-dione. InChIKey: INVMZALXDUDUFO-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 5-benzyl-5-azaspiro[2.4]heptane-4,7-dione |
| InChIKey | INVMZALXDUDUFO-UHFFFAOYSA-N |
| SMILES | C1CC12C(=O)CN(C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)