Products 1293370-64-5

CAS 1293370-64-5 is the registry number for 1-tert-Butyl 3-methyl 1,4,5,6-tetrahydropyridine-1,3-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

1-O-tert-butyl 5-O-methyl 3,4-dihydro-2H-pyridine-1,5-dicarboxylate (CAS 1293370-64-5) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl 3,4-dihydro-2H-pyridine-1,5-dicarboxylate. InChIKey: WRFDLNYBZIBNCC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19NO4
Molecular weight241.28 g/mol
IUPAC name1-O-tert-butyl 5-O-methyl 3,4-dihydro-2H-pyridine-1,5-dicarboxylate
InChIKeyWRFDLNYBZIBNCC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(=C1)C(=O)OC

Computed by PubChem (NCBI)