CAS 1293372-65-2 is the registry number for (4R,5S)-4,5-Diphenyl-1,2,3-oxathiazolidine-2,2-dioxide-3-carboxylic acid t-butyl ester, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 50mg, 250mg, 1g.
Tert-butyl (4R,5S)-2,2-dioxo-4,5-diphenyloxathiazolidine-3-carboxylate (CAS 1293372-65-2) is a chemical compound with the molecular formula C19H21NO5S and a molecular weight of 375.4 g/mol. IUPAC name: tert-butyl (4R,5S)-2,2-dioxo-4,5-diphenyloxathiazolidine-3-carboxylate. InChIKey: JDAQQQAWXWYTJM-SJORKVTESA-N.
| Molecular formula | C19H21NO5S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | tert-butyl (4R,5S)-2,2-dioxo-4,5-diphenyloxathiazolidine-3-carboxylate |
| InChIKey | JDAQQQAWXWYTJM-SJORKVTESA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@@H](OS1(=O)=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)