CAS 158654-83-2 is the registry number for (S)-Benzyl 3-(tosyloxy)pyrrolidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 25g.
Benzyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate (CAS 158654-83-2) is a chemical compound with the molecular formula C19H21NO5S and a molecular weight of 375.4 g/mol. IUPAC name: benzyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate. InChIKey: SMCDOKNEALHLNF-KRWDZBQOSA-N.
| Molecular formula | C19H21NO5S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | benzyl (3S)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
| InChIKey | SMCDOKNEALHLNF-KRWDZBQOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@H]2CCN(C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)