Products 1858251-17-8
CAS 1858251-17-8 is the registry number for 6-tert-Butyl-4-(phenylsulfonyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(benzenesulfonyl)-6-tert-butyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CAS 1858251-17-8) is a chemical compound with the molecular formula C19H21NO5S and a molecular weight of 375.4 g/mol. IUPAC name: 4-(benzenesulfonyl)-6-tert-butyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid. InChIKey: BCPVEPDWXQDIFA-UHFFFAOYSA-N.
| Molecular formula | C19H21NO5S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 4-(benzenesulfonyl)-6-tert-butyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | BCPVEPDWXQDIFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(CN2S(=O)(=O)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)