CAS 1293987-58-2 is the registry number for 7-bromothieno[3,2-d]pyrimidin-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
7-bromothieno[3,2-d]pyrimidin-2-amine (CAS 1293987-58-2) is a chemical compound with the molecular formula C6H4BrN3S and a molecular weight of 230.09 g/mol. IUPAC name: 7-bromothieno[3,2-d]pyrimidin-2-amine. InChIKey: LZLZYXOVUQZYDQ-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3S |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 7-bromothieno[3,2-d]pyrimidin-2-amine |
| InChIKey | LZLZYXOVUQZYDQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)N)C(=CS2)Br |
Computed by PubChem (NCBI)