CAS 1294455-12-1 is the registry number for 4,4'-(1,3-Phenylene)bis(4-oxobutanoic acid). Offered by: TRC. Available pack sizes: 250mg.
4-[3-(3-carboxypropanoyl)phenyl]-4-oxobutanoic acid (CAS 1294455-12-1) is a chemical compound with the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. IUPAC name: 4-[3-(3-carboxypropanoyl)phenyl]-4-oxobutanoic acid. InChIKey: JRCKUZPLPMOXJE-UHFFFAOYSA-N.
| Molecular formula | C14H14O6 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 4-[3-(3-carboxypropanoyl)phenyl]-4-oxobutanoic acid |
| InChIKey | JRCKUZPLPMOXJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)CCC(=O)O)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)